| Identification | |
| Name: | 1-Naphthalenol,4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]- |
| CAS: | 10476-53-6 |
| Molecular Formula: | C16H21 N O3 |
| Molecular Weight: | 311.8 |
| InChI: | InChI=1/C16H21NO3/c1-2-9-17-10-12(18)11-20-16-8-7-15(19)13-5-3-4-6-14(13)16/h3-8,12,17-19H,2,9-11H2,1H3 |
| Molecular Structure: | ![(C16H21NO3) 2-Propanol,1-[(4-hydroxy-1-naphthyl)oxy]-3-(isopropylamino)- (8CI); (?à)-4-Hydroxypropranolol; 4-Hy...](https://img1.guidechem.com/chem/e/dict/15/10476-53-6.jpg) |
| Properties | |
| Flash Point: | 248.6°C |
| Boiling Point: | 487.5°Cat760mmHg |
| Density: | 1.168g/cm3 |
| Refractive index: | 1.604 |
| Specification: | Off-White to Pale Purple Solid usageEng:A metabolite of Propranolol |
| Flash Point: | 248.6°C |
| Usage: | A metabolite of Propranolol |
| Safety Data | |
 |
|
