| Identification | |
| Name: | Benzeneacetic acid,4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]- |
| Synonyms: | 4-(2-Hydroxy-3-isopropylaminopropoxy)phenylaceticacid; Atenolol acid; H 117/04; Metoprolol acid; SL 77-010 |
| CAS: | 56392-14-4 |
| Molecular Formula: | C14H21 N O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C14H21NO4/c1-10(2)15-8-12(16)9-19-13-5-3-11(4-6-13)7-14(17)18/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 242.3°C |
| Boiling Point: | 477.1°Cat760mmHg |
| Density: | 1.159g/cm3 |
| Refractive index: | 1.539 |
| Specification: | Off-white Solid usageEng:The acidic inactive metabolite of Metoprolol |
| Flash Point: | 242.3°C |
| Usage: | The acidic inactive metabolite of Metoprolol |
| Safety Data | |
 |
|
