| Identification | |
| Name: | 1-Pentanol, 2-methyl- |
| Synonyms: | 2-MPOH;2-Methyl-1-pentanol;2-Methylpentanol-1;NSC 6250; |
| CAS: | 105-30-6 |
| EINECS: | 203-285-1 |
| Molecular Formula: | C6H14O |
| Molecular Weight: | 102.20 |
| InChI: | InChI=1/C6H14O/c1-3-4-6(2)5-7/h6-7H,3-5H2,1-2H3/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 3/PG 3 |
| Refractive index: | n20/D 1.418(lit.) |
| Appearance: | clear colourless liquid |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
