| Identification | |
| Name: | 1-Pentanol, 2-methyl-,1-acetate |
| Synonyms: | 1-Pentanol,2-methyl-, acetate (8CI,9CI) |
| CAS: | 7789-99-3 |
| Molecular Formula: | C8H16 O2 |
| Molecular Weight: | 144.24 |
| InChI: | InChI=1/C8H16O2/c1-4-5-7(2)6-10-8(3)9/h7H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3272 |
| Flash Point: | 46.7°C |
| Boiling Point: | 160 °C |
| Density: | 0,87 g/cm3 |
| Refractive index: | 1.411 |
| Specification: |
2-Methylamyl acetate ,its cas register number is 7789-99-3. It also can be called 1-Pentanol, 2-methyl-, acetate ; 1-Pentanol, 2-methyl-, 1-acetate ; and Acetic acid 2-methylpentyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 46.7°C |
| Safety Data | |
 |
|
