| Identification | |
| Name: | 1-Hexyn-3-ol |
| CAS: | 105-31-7 |
| EINECS: | 203-286-7 |
| Molecular Formula: | C6H10 O |
| Molecular Weight: | 98.14 |
| InChI: | InChI=1/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2929 6.1/PG 1 |
| Flash Point: | 117 °F |
| Density: | 0.87 |
| Refractive index: | n20/D 1.431 |
| Specification: | Safety Statements:26-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 117 °F |
| Safety Data | |
 |
|
