| Identification | |
| Name: | 3-Hexyn-2-ol |
| Synonyms: | 2-Hydroxy-3-hexyne; |
| CAS: | 109-50-2 |
| EINECS: | 203-676-7 |
| Molecular Formula: | C6H10O |
| Molecular Weight: | 98.14 |
| InChI: | InChI=1/C6H10O/c1-3-4-5-6(2)7/h6-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 |
| Flash Point: | 128? |
| Density: | 0.909 |
| Refractive index: | 1.447 |
| Specification: | Safety Statements:61 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Flash Point: | 128? |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
