| Identification | |
| Name: | Ethyl bromoacetate |
| CAS: | 105-36-2 |
| EINECS: | 203-290-9 |
| Molecular Formula: | C4H7BrO2 |
| Molecular Weight: | 167 |
| InChI: | InChI=1/C4H7BrO2/c1-2-7-4(6)3-5/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1603 |
| Density: | 1.506 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, water, strong acids. |
| Refractive index: | 1.45-1.452 |
| Water Solubility: | Flammable, Insoluble in water |
| Solubility: | Flammable, Insoluble in water |
| Appearance: | colourless to light yellow liquid |
| Specification: |
?Ethyl 2-bromoacetate (CAS NO.105-36-2), its Synonyms are Acetic acid, bromo-, ethyl ester ; Antol ; Ethyl bromoacetate ; Bromoacetic acid, ethyl ester ; Ethoxycarbonylmethyl bromide ; Ethyl alpha-bromoacetate ; Acetic acid, 2-bromo-, ethyl ester .It is colourless to light yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Color: | Clear colorless liquid |
| Usage: | Has been employed as tear gas. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
