| Identification | |
| Name: | Methyl bromoacetate |
| Synonyms: | Bromoacetic acid methyl ester; METHYL 2-BROMOACETATE; |
| CAS: | 96-32-2 |
| EINECS: | 202-499-2 |
| Molecular Formula: | C3H5BrO2 |
| Molecular Weight: | 152.97 |
| InChI: | InChI=1/C3H5BrO2/c1-6-3(5)2-4/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2643 |
| Density: | 1.616 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.457-1.459 |
| Water Solubility: | Insoluble IN WATER |
| Solubility: | Insoluble IN WATER |
| Appearance: | clear to slightly yellow liquid |
| Specification: |
?Methyl bromoacetate , its CAS NO. is 96-32-2, the synonyms are Methyl alpha-bromoacetate ; Methyl monobromoacetate ; Methylester kyseliny bromoctove ; Acetic acid, 2-bromo-, methyl ester ; Acetic acid, bromo-, methyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Store at R.T. |
| Usage: | Used to make vitamins and pharmaceuticals. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
