| Identification | |
| Name: | sec-Butyl Acetate |
| Synonyms: | DL-sec-Butyl acetate; sec-BUTYL ACETATE, 98%; ; Acetic acid,sec-butyl ester; sec-Butyl ethanoate |
| CAS: | 105-46-4 |
| EINECS: | 203-300-1 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1123 |
| Density: | 0.87 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.388-1.39 |
| Solubility: | Slightly soluble |
| Appearance: | Clear liquid |
| Specification: |
?Sec-Butyl acetate has three isomers: n-butyl acetate, isobutyl acetate, and tert-butyl acetate.It is a clear flammable liquid with a sweet smell. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS, TRANSPARENT SOLID |
| Usage: | Solvent for nitrocellulose lacquers, thinners, nail enamels, leather finishes. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
