| Identification | |
| Name: | Iso-propyl chloroacetate |
| Synonyms: | Aceticacid, chloro-, 1-methylethyl ester (9CI); Acetic acid, chloro-, isopropyl ester(6CI,7CI,8CI); 1-Methylethyl monochloroacetate; Isopropyl 2-chloroacetate;Isopropyl chloroacetate; NSC 27789 |
| CAS: | 105-48-6 |
| EINECS: | 203-301-7 |
| Molecular Formula: | C5H9ClO2 |
| Molecular Weight: | 136.58 |
| InChI: | InChI=1/C5H9ClO2/c1-4(2)8-5(7)3-6/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2947 |
| Melting Point: | -112 |
| Density: | 1.096 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.418-1.42 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble in Water |
| Appearance: | A clear colorless liquid. |
| Specification: |
Acetic acid, 2-chloro-, 1-methylethyl ester , its CAS NO. is 105-48-6, the synonyms are Chloroacetic acid isopropyl ester ; EINECS 203-301-7 ; Isopropyl chloroacetate ; NSC 27789 ; Acetic acid, chloro-, 1-methylethyl ester ; Chloroacetic acid isopropyl ester ; Isopropyl chloroacetate . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
