| Identification | |
| Name: | Peroxydicarbonic acid,C,C'-bis(1-methylethyl) ester |
| Synonyms: | Peroxydicarbonicacid, bis(1-methylethyl) ester (9CI); Peroxydicarbonic acid, diisopropyl ester(6CI,8CI); Bisisopropyl peroxydicarbonate; Di-iso-propyl peroxydicarbonate;Diisopropyl percarbonate; Diisopropyl perdicarbonate; Diisopropylperoxydicarbonate; Diisopropyl peroxydiformate; IPP; Isopropylperoxydicarbonate; Luperox IPP; Perkadox IPP; Peroyl IPP |
| CAS: | 105-64-6 |
| EINECS: | 203-317-4 |
| Molecular Formula: | C8H14 O6 |
| Molecular Weight: | 206.19 |
| InChI: | InChI=1/C8H14O6/c1-5(2)11-7(9)13-14-8(10)12-6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2133/2134 |
| Density: | 1.138 g/cm3 |
| Stability: | Stability Shock-sensitive. Highly reactive. Heat sensitive. May explode or ignite in contact with organic material. |
| Refractive index: | 1.4034 |
| Solubility: | Insoluble |
| Appearance: | Colorless, crystalline solid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Crystalline solid Colorless |
| Usage: | Low temp polymerization catalyst. |
| Safety Data | |
| Hazard Symbols | |
 |
|
