| Identification |
| Name: | Thioperoxydicarbonicacid ([(HO)C(S)]2S2), C,C'-bis(1-methylethyl) ester |
| Synonyms: | Formicacid, dithiobis[thio-, O,O-diisopropyl ester (6CI,8CI);Thioperoxydicarbonicacid ([(HO)C(S)]2S2), bis(1-methylethyl) ester (9CI);Bis(2-propyl)dixanthogen;Bis(O-isopropylxanthyl) disulfide;Diisopropyltetrathioperoxydicarbonate;Diisopropylxanthogen disulfide;Diproxide;NSC 402565;SanbitDIX; |
| CAS: | 105-65-7 |
| EINECS: | 203-319-5 |
| Molecular Formula: | C8H14O2S4 |
| Molecular Weight: | 270.46 |
| InChI: | InChI=1/C8H14O2S4/c1-5(2)9-7(11)13-14-8(12)10-6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |
![(C8H14O2S4) Formicacid, dithiobis[thio-, O,O-diisopropyl ester (6CI,8CI);Thioperoxydicarbonicacid ([(HO)C(S)]2S2...](https://img.guidechem.com/casimg/105-65-7.gif) |
| Properties |
| Flash Point: | 130.347°C |
| Boiling Point: | 295.398°C at 760 mmHg |
| Density: | 1.214g/cm3 |
| Refractive index: | 1.509 |
| Specification: |
Isopropyl xanthogen disulfide (105-65-7),which also can be called for Bis(1-methylethyl)ester-thioperoxydicarbonicaci ; Bis(1-methylethyl)esterthioperoxydicarbonicacid ; Bis(2-propyl)dixanthogen ; Bis(isopropylxanthogen)disulfide ; Bis(o-isopropylxanthyl)disulfide ; Bis-iso-propylxanthogenate ; Diisopropyldixanthogen ; Diisopropylxanthogenatedisulfide .When Isopropyl xanthogen disulfide (105-65-7) was heated,it emits toxic vapors of SOx .
|
| Flash Point: | 130.347°C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |