| Identification | |
| Name: | 2,4-Dimethylphenol |
| Synonyms: | 2,4-Xylenol; 1-Hydroxy-2,4-dimethylbenzene |
| CAS: | 105-67-9 |
| EINECS: | 203-321-6 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-6-3-4-8(9)7(2)5-6/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2261 |
| Density: | 1.027 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5375-1.5405 |
| Solubility: | 0.5 g/100 mL (25 ºC) |
| Appearance: | clear colorless to yellow liquid |
| Specification: |
2,4-Xylenol (CAS NO.105-67-9), its Synonyms are 2,4-Dimethylphenol ; 1-Hydroxy-2,4-dimethylbenzene ; 4,6-Dimethylphenol ; 4-Hydroxy-1,3-dimethylbenzene ; Bacticin ; Benzene, 2,4-dimethyl-1-hydroxy- ; Bulk Lysol Brand Disinfectant ; Lysol Brand disinfectant ; Phenol, 2,4-dimethyl- . It is clear colorless to yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29071400 |
| Storage Temperature: | 2-8°C |
| Color: | Crystals NEEDLES FROM WATER Colorless needles |
| Usage: | Manufacture of pharmaceuticals, plastics, insecticides, fungicides, rubber chem, wetting agents, dyestuffs. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
