| Identification | |
| Name: | 5-Chloroindole-2-carboxylic acid |
| Synonyms: | 5-Chloro indole-2-carboxylic acid;5-Chloroindole-2-carboxylicacid;5-chloro-1H-indole-2-carboxylate;5-Chloroindole-2-carboxylate;1H-Indole-2-carboxylic acid, 5-chloro-;5-chloro-1H-indole-2-carboxylic acid; |
| CAS: | 10517-21-2 |
| EINECS: | 234-050-1 |
| Molecular Formula: | C9H6ClNO2 |
| Molecular Weight: | 195.6 |
| InChI: | InChI=1/C9H6ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.548 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Almost white powder |
| Specification: | light pink to beige or light brown fine Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29339990 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
