| Identification | |
| Name: | 7-Chloroindole |
| Synonyms: | 7-Chloro-1H-indole; |
| CAS: | 53924-05-3 |
| EINECS: | 258-865-7 |
| Molecular Formula: | C8H6ClN |
| Molecular Weight: | 151.59294 |
| InChI: | InChI=1S/C8H6ClN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158.9oC |
| Density: | 1.331 g/cm3 |
| Refractive index: | 1.688 |
| Water Solubility: | Soluble in ethanol and acetic acid |
| Solubility: | Soluble in ethanol and acetic acid |
| Appearance: | White to off-white crystalline powder. |
| Specification: |
?7-Chloroindole?(CAS NO.53924-05-3) is also called as?7-Chloroindazole ; 1H-indole,7-chloro-(9ci) ; 7-Chloroindole,98% . |
| HS Code: | 29339990 |
| Flash Point: | 158.9oC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
