| Identification |
| Name: | 1,2-Benzenediol,4-(2-hydroxyethyl)- |
| Synonyms: | Phenethylalcohol, 3,4-dihydroxy- (6CI,7CI,8CI);1-(2-Hydroxyethyl)-3,4-dihydroxybenzene;2-(3,4-Dihydroxyphenyl)ethanol;2-(3,4-Dihydroxyphenyl)ethyl alcohol;3,4-DHPEA;3,4-Dihydroxy-b-phenethyl alcohol;3,4-Dihydroxyphenethyl alcohol;3,4-Dihydroxyphenylethyl alcohol;3-Hydroxytyrosol;4-(2-Hydroxymethyl)-1,2-benzenediol;Ba 2774;Homoprotocatechuyl alcohol;Hydroxytyrosol;b-(3,4-Dihydroxyphenyl)ethanol;b-(3,4-Dihydroxyphenyl)ethylalcohol; |
| CAS: | 10597-60-1 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.321 g/cm3 |
| Refractive index: | 1.622 |
| Appearance: | Yellow green powder |
| Specification: |
?3,4-Dihydroxyphenylethanol , its cas register number is 10597-60-1. It also can be called 2-(3,4-Dihydroxyphenyl)ethanol ; beta-3,4-Dihydroxyphenylethyl alcohol ; and 1,2-Benzenediol, 4-(2-hydroxyethyl)- . 3,4-Dihydroxyphenylethanol (CAS NO.10597-60-1) is considered one of the most powerful anti-oxidants . Its oxygen radical absorbance capacity is 40,000 umolTE/g.
|
| Storage Temperature: | Refrigerator |
| Usage: | Tyrosol (T947800) metabolite. |
| Safety Data |
| |
 |