| Identification | |
| Name: | Ethyl laurate |
| Synonyms: | Lauricacid, ethyl ester (6CI,8CI);Ethyl dodecanoate;Ethyl dodecylate;Ethyllaurate;Ethyl laurinate;Ethyl n-dodecanoate;NSC 83467;NSC 8912;Dodecanoic acid, ethylester; |
| CAS: | 106-33-2 |
| EINECS: | 203-386-0 |
| Molecular Formula: | C14H28O2 |
| Molecular Weight: | 228.37 |
| InChI: | InChI=1/C14H28O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2/h3-13H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100 C |
| Density: | 0.863 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.43-1.434 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble Appearance:Clear liquid Hazard Symbols:UN NO. particular:particular |
| Appearance: | Clear liquid |
| Specification: | clear colorless to slightly yellowish liquid Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Packinggroup: | Z01 |
| HS Code: | 29159080 |
| Flash Point: | 100 C |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
