| Identification | |
| Name: | PEG-30 glyceryl laurate |
| Synonyms: | PEG-12 GLYCERYL LAURATE;PEG-20 GLYCERYL LAURATE;PEG-23 GLYCERYL LAURATE;PEG-30 GLYCERYL LAURATE;Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, ether with 1,2,3-propanetriol monododecanoate (2:1);Glycerinmonolaurat, ethoxiliert, EO 12 und 20 mol;etriol monododecanoate;Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, ether with 1,2,3-propanetriol monododecanoate |
| CAS: | 51248-32-9 |
| Molecular Formula: | C19H38O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C19H38O6/c1-2-3-4-5-6-7-8-9-10-11-19(22)25-17-18(24-15-13-21)16-23-14-12-20/h18,20-21H,2-17H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156.9°C |
| Boiling Point: | 480.9°Cat760mmHg |
| Density: | 1.024g/cm3 |
| Flash Point: | 156.9°C |
| Safety Data | |
 |
|
