| Identification | |
| Name: | n-Propyl propionate |
| Synonyms: | 1-propylpropanoate; n-Propyl n-propionate; n-Propyl propanoate; Propanoicacid,propylester; propanoicacidpropylester; Propyl ester of propanoic acid; Propylester kyseliny propionove; propylesterkyselinypropionove; Propyl propionate |
| CAS: | 106-36-5 |
| EINECS: | 203-389-7 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-3-5-8-6(7)4-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Flash Point: | 76? |
| Density: | 0.881 |
| Refractive index: | 1.393 |
| Appearance: | Colorless to pale yellowliquid |
| Specification: | Clear colorless liquid Safety Statements:24 24:Avoid contact with skin |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 76? |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
