| Identification | ||
| Name: | p-Bromo Aniline | |
| Synonyms: | 4-Bromoaniline; p-Bromoaniline | |
| CAS: | 106-40-1 | |
| EINECS: | 203-393-9 | |
| Molecular Formula: | C6H6BrN | |
| Molecular Weight: | 172.02 | |
| InChI: | InChI=1/C6H6BrN/c7-5-1-3-6(8)4-2-5/h1-4H,8H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2811 6.1/PG 3 | |
| Density: | 1.5 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, peroxides, acids, acid chlorides, acid anhydrides, chloroformates. May be air sensitive. | |
| Refractive index: | 1.5835 (99.6 C) | |
| Water Solubility: | <0.1 g/100 mL at 23 ºC | |
| Appearance: | crystalline | |
| Specification: |
? 4-Bromoaniline , with CAS number of 106-40-1, can be called 4-Bromanilinu ; 4-Bromo-aniline ; Aniline, p-bromo- ; Benzenamine, 4-bromo- ; p-Bromophenylamine ; p-Bromoaniline .?It is a?crystalline,?4-Bromoaniline (CAS NO.106-40-1) is sensitive to prolonged exposure to air. Vapor may form highly reactive mixtures in air . Insoluble in water, with?highly reactive mixtures in air.?Flash point data are not available for 4-Bromoaniline, but 4-Bromoaniline is probably combustible. | |
| Report: |
?4-Bromoaniline (CAS NO.106-40-1) is reported in EPA TSCA Inventory. | |
| Packinggroup: | III | |
| HS Code: | 29214210 | |
| Storage Temperature: | Store in a cool place in the original container and protect from sunlight. Store in a tightly closed container. | |
| Color: | white to light yellow | |
| Usage: | In prepn of azo dyes, condensed with formaldehyde in prepn of dihydroquinazolines. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
