| Identification | |
| Name: | P-Bromophenol |
| Synonyms: | 1,4-bromophenol; 4-bromo-pheno; p-bromohydroxybenzene; p-bromophenicacid; p-bromo-pheno; Phenol, 4-bromo-; Phenol, p-bromo-; Phenol,4-bromo-; 4-Bromophenol |
| CAS: | 106-41-2 |
| EINECS: | 203-394-4 |
| Molecular Formula: | C6H5BrO |
| Molecular Weight: | 173.01 |
| InChI: | InChI=1/C6H5BrO/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.84 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.604 |
| Solubility: | Insoluble |
| Appearance: | pinkish-brown crystalline solid |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Tetragonal bipyramidal crystals from chloroform or ether |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
