| Identification | |
| Name: | 2-Bromophenol |
| Synonyms: | 2-Bromphenol |
| CAS: | 95-56-7 |
| EINECS: | 202-432-7 |
| Molecular Formula: | C6H5BrO |
| Molecular Weight: | 173.01 |
| InChI: | InChI=1/C6H5BrO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.492 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.588-1.59 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Clear, colorless to slightly yellow liquid. |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:16-36/37/39-37/39-26-36 16:Keep away from sources of ignition - No smoking 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Flammables area |
| Color: | Yellow to red oily liquid |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
