| Identification | |
| Name: | p-Toluidine |
| Synonyms: | 4-Aminotoluene; 4-Methylaniline; Naphthol As-Kg; Azoic Diazo Component 107; 4-Toluidine; Para Toluidine; PT; |
| CAS: | 106-49-0 |
| EINECS: | 203-403-1 |
| Molecular Formula: | C7H9N |
| Molecular Weight: | 107.15 |
| InChI: | InChI=1/C7H9N/c1-6-2-4-7(8)5-3-6/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3451 6.1/PG 2 |
| Density: | 0.962 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.5636 |
| Water Solubility: | 1.1 g/100 mL |
| Solubility: | 1.1 g/100 mL |
| Appearance: | white lustrous plates or leaflets with an amine odour |
| Specification: |
?p-Toluidine (CAS NO.106-49-0), its Synonyms are 4-Aminotoluene ; 4-Toluidine ; 1-Amino-4-methylbenzene ; 4-Amino-1-methylbenzene ; 4-Methylaniline ; 4-Methylbenzenamine ; Aniline, p-methyl- ; Benzenamine, 4-methyl- ; p-Methylbenzenamine . It is white lustrous plates or leaflets with an amine odour. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| HS Code: | 38220000 |
| Color: | tan to brown |
| Usage: | Dyes, organic synthesis, reagent for lignin, nitrite, chloroglucinol. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
