| Identification |
| Name: | 3-bromo-p-toluidine |
| Synonyms: | 3-Bromo-1,4-toluidine; 3-bromo-4-methyl-benzenamin; 3-Bromo-4-methyl-phenylamine; 3-bromo-p-toluidin; p-Toluidine, 3-bromo-; 4-AMINO-2-BROMOTOLUENE; 3-BROMO-4-METHYLANILINE; 3-bromo-4-methylbenzenamine |
| CAS: | 7745-91-7 |
| EINECS: | 231-807-8 |
| Molecular Formula: | C7H8BrN |
| Molecular Weight: | 186.05 |
| InChI: | InChI=1/C7H8BrN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.498 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.611-1.613 |
| Solubility: | Insoluble |
| Appearance: | Yellow to Brown (Liquid) or Off-White to Brown Liquid or Solid |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
