| Identification | |
| Name: | 2-Propenoic acid,2-oxiranylmethyl ester |
| Synonyms: | 2-Propenoicacid, oxiranylmethyl ester (9CI);Acrylic acid, 2,3-epoxypropyl ester(6CI,8CI);Acrylic acid, glycidyl ester (5CI);2,3-Epoxypropyl acrylate;Epoxypropyl acrylate;Glycidyl propenoate;NSC 24151;NSC67196; |
| CAS: | 106-90-1 |
| EINECS: | 203-440-3 |
| Molecular Formula: | C6H8O3 |
| Molecular Weight: | 128.14 |
| InChI: | InChI=1/C6H8O3/c1-2-6(7)9-4-5-3-8-5/h2,5H,1,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | Freezing point: -41.5 deg C |
| Density: | 1.129 g/cm3 |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents. May be prone to polymerization. |
| Refractive index: | 1.457 |
| Water Solubility: | moderate |
| Solubility: | moderate |
| Appearance: | amber liquid |
| Specification: | amber liquid usageEng:Labelled Glycidyl Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Color: | Liquid |
| Usage: | Labelled Glycidyl |
| Safety Data | |
| Hazard Symbols | |
 |
|
