| Identification | |
| Name: | Butanoic acid,2-oxiranylmethyl ester |
| CAS: | 2461-40-7 |
| Molecular Formula: | C7H12 O3 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C7H12O3/c1-2-3-7(8)10-5-6-4-9-6/h6H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.069 g/cm3 |
| Refractive index: | 1.444 |
| Specification: |
Glycidyl butyrate (2461-40-7) is a colorless and transparent liquid, insoluble in water, almost insoluble in all organic solvents, on the skin and mucous membrane irritant, almost non-toxic. Because of its carbon-carbon molecule that contains both the double bond, but also contains epoxy groups, both to free radical-type reaction, but also for ion-type reaction, therefore, has a very high response flexibility to separate the different reactions. widely used in medicine, photosensitive materials, organic synthesis and polymer-modified and other fields. derived products have excellent anti-UV, water-resistant heat-resistant characteristics, is an important fine chemical raw material. |
| Safety Data | |
 |
|
