| Identification | |
| Name: | Glycine,N-methyl- |
| Synonyms: | Sarcosine(8CI);(Methylamino)acetic acid;(Methylamino)ethanoic acid;2-(Methylamino)acetic acid;Acetic acid, (methylamino)-;Methylglycine;N-Methylaminoaceticacid;N-Methylglycine;Sarcosin;Sarcosinic acid; |
| CAS: | 107-97-1 |
| EINECS: | 203-538-6 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.09 |
| InChI: | InChI=1/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.093 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4658 (20 C) |
| Appearance: | white crystalline powder |
| HS Code: | 29224995 |
| Biological Activity: | Endogenous inhibitor of GlyT1 that displays antipsychotic activity. Potentiates the action of glycine on the NMDA glycine binding site. |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Usage: | Under investigation for the possible prevention of schizophrenic illness during the prodromal stage of the disease. |
| Safety Data | |
 |
|
