Identification |
Name: | Acetopropyl alcohol |
Synonyms: | 3-Acetopropanol;3-Acetyl-1-propanol;3-Acetylpropanol;4-Oxo-1-pentanol;5-Hydroxy-2-pentanone;NSC 19158;NSC 33940;g-Acetopropanol;g-Acetopropyl alcohol;2-Pentanone, 5-hydroxy-; |
CAS: | 1071-73-4 |
EINECS: | 213-994-8 |
Molecular Formula: | C5H10O2 |
Molecular Weight: | 102.13 |
InChI: | InChI=1/C5H10O2/c1-5(7)3-2-4-6/h6H,2-4H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 33562 |
Density: | 1.007 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.437-1.44 |
Solubility: | Very soluble |
Appearance: | clear colorless liquid |
Packinggroup: | O52 |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |