| Identification | |
| Name: | unsym-Dimethylethylenediamine |
| Synonyms: | 2-Dimethylaminoethylamine; N,N-Dimethylethylenediamine; 2-aminoethyldimethylamine; N,N-Dimethyl-1,2-ethylenediamine; N-(2-Aminoethyl)-N,N-dimethylamine; N,N-Dimethyl-1,2-diaminoethane; N,N'-Dimethyl-1,2-ethandiamine; ACRYLIC ACID 2-(DIMETHYLAMINO)ETHYL ESTER; ACRYLIC ACID 2-(N,N-DIMETHYLAMINO)ETHYL ESTER; 2-(DIMETHYLAMINO)ETHYL ACRYULATE |
| CAS: | 108-00-9 |
| EINECS: | 203-541-2 |
| Molecular Formula: | C4H12N2 |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C4H12N2/c1-6(2)4-3-5/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 |
| Density: | 0.807 |
| Stability: | No data. |
| Refractive index: | 1.4255-1.4275 |
| Water Solubility: | MISCIBLE |
| Solubility: | MISCIBLE |
| Appearance: | light yellow - colorless |
| Specification: | clear colorless to pale yellow liquid Safety Statements:26-28-36/37/39-45-36-28A-23-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | II |
| HS Code: | 29212900 |
| Storage Temperature: | Flammables area |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
