| Identification | |
| Name: | Gamma-Valerolactone |
| Synonyms: | 4,5-Dihydro-5-methyl-2(3H)-furanone~4-Hydroxypentanoic acid lactone~gamma-Pentanolactone |
| CAS: | 108-29-2 |
| EINECS: | 203-569-5 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.12 |
| InChI: | InChI=1/C5H8O2/c1-4-2-3-5(6)7-4/h4H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.05 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.432-1.434 |
| Water Solubility: | MISCIBLE |
| Solubility: | MISCIBLE |
| Appearance: | colorless to pale yellow clear liquid |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:39-26 39:Wear eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | I; II; III |
| HS Code: | 29322980 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Used in the perfume and flavor industries. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
