| Identification |
| Name: | gamma-hexalactone |
| Synonyms: | gamma-Caprolactone; hexan-4-olide; gamma-Hexanolactone; gamma-Hexalactone~gamma-Hexanolactone; r-Hexyl Lactone |
| CAS: | 695-06-7 |
| EINECS: | 211-778-8 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-2-5-3-4-6(7)8-5/h5H,2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 209? |
| Density: | 1.023 |
| Refractive index: | 1.439 |
| Appearance: | colourless to pale yellow liquid with a herbaceous, sweet odour |
| Flash Point: | 209? |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
