| Identification | |
| Name: | 2,6-Dimethylpyrazine |
| Synonyms: | 3,5-Dimethylpyrazole |
| CAS: | 108-50-9 |
| EINECS: | 203-589-4 |
| Molecular Formula: | C6H8N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-5-3-7-4-6(2)8-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 4.1/PG 2 |
| Density: | 0.997g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5000 |
| Solubility: | Soluble |
| Appearance: | Clear, colorless liquid. |
| Specification: | PALE YELLOW LOW MELTING CRYSTALLINE SOLID Safety Statements:16-26-39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection |
| Packinggroup: | III |
| HS Code: | 29339990 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
