| Identification | |
| Name: | 2,5-Dimethylpyrazine |
| Synonyms: | NSC 49139;2.5-dimethyl pyrazine;2,5-Dimethyl pyrazine;AI3-60303;CCRIS 2929;FEMA No. 3272; |
| CAS: | 123-32-0 |
| EINECS: | 204-618-3 |
| Molecular Formula: | C6H8N2 |
| Molecular Weight: | 108.14 |
| InChI: | InChI=1/C6H8N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.99 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.491-1.493 |
| Solubility: | Soluble |
| Appearance: | clear colorless to pale yellow liquid |
| Specification: |
?2,5-Dimethylpyrazine?(CAS NO.123-32-0) is also called as?2,5-Dimethyl-1,4-diazine?;?Pyrazine, 2,5-dimethyl- ;?2,5-Dimethylparadiazine?; 2,5-Dimethylpyrazine (natural)?. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29339990 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
