| Identification | |
| Name: | Butyl butyrate |
| Synonyms: | Butyl n-butyrate; n-Butyl butyrate; n-Butyl n-Butyrate |
| CAS: | 109-21-7 |
| EINECS: | 203-656-8 |
| Molecular Formula: | C8H16O2 |
| Molecular Weight: | 144.21 |
| InChI: | InChI=1/C8H16O2/c1-3-5-7-10-8(9)6-4-2/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2528 |
| Density: | 0.8675 |
| Refractive index: | 1.405-1.407 |
| Solubility: | Insoluble in water, but soluble in ethanol and ethyl ether |
| Appearance: | colorless liquid |
| Specification: | CLEAR COLORLESS TO PALE YELLOWISH LIQUID Safety Statements:2 2:Keep out of the reach of children |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols | |
 |
|
