| Identification | ||
| Name: | Isoamyl nitrite | |
| Synonyms: | Isopentylalcohol, nitrite (8CI);3-Methylbutanol nitrite;3-Methylbutyl nitrite;Amylnitrite;Aspiral;NSC 7903;Nitramyl;Nitrous acid, isopentyl ester;Pentyl nitrite;Vaporole; | |
| CAS: | 110-46-3 | |
| EINECS: | 203-770-8 | |
| Molecular Formula: | C5H11NO2 | |
| Molecular Weight: | 117.15 | |
| InChI: | InChI=1/C5H11NO2/c1-5(2)3-4-8-6-7/h5H,3-4H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 1113 | |
| Density: | 0.872 | |
| Stability: | Stability Unstable. Air and light sensitive. Flammable. Forms explosive mixtures with air or oxygen. Incompatible with oxidizing agents, reducing agents. | |
| Refractive index: | 1.3855-1.3875 | |
| Water Solubility: | <0.01 g/100 mL at 18 ºC | |
| Solubility: | <0.01 g/100 mL at 18 oC | |
| Appearance: | yellow liquid | |
| Specification: | yellow liquid Safety Statements:16-24-46 16:Keep away from sources of ignition - No smoking 24:Avoid contact with skin 46:If swallowed, seek medical advice immediately and show this container or label | |
| Packinggroup: | II | |
| Sensitive: | Air & Light Sensitive | |
| Color: | Yellowish, transparent liquid | |
| Safety Data | ||
| Hazard Symbols |
F:Flammable
|
|
 |
||
