| Identification | |
| Name: | Dicyclohexylammonium nitrite |
| Synonyms: | Dichan;VP 1260;NDA (corrosion inhibitor);VPI 260;Diana (corrosion inhibitor);Leukorrosin C;TVI;N-cyclohexylcyclohexanamine; nitrous acid;Cyclohexanamine,N-cyclohexyl-,nitrite;DICYCLOHEXYLAMINE NITRITE;DODECAHYDROPHENYLAMINE NITRITE;DUSITAN DICYKLOHEXYLAMINU (CZECH);DECHAN;DICHAN (CZECH);DICYCLOHEXYL-AMINONITRITE;DICYNIT (CZECH);DICYKLOHEXYLAMIN NITRIT (CZECH);N,N-Dicyclohexylammonium nitrite; |
| CAS: | 3129-91-7 |
| EINECS: | 221-515-9 |
| Molecular Formula: | C12H23N.HNO2 |
| Molecular Weight: | 228.33 |
| InChI: | InChI=1/C12H23N.HNO2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1-3/h11-13H,1-10H2;(H,2,3) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 268 |
| Flash Point: | 100 C |
| Boiling Point: | 256.1°Cat760mmHg |
| Density: | 0.91g/cm3 |
| Stability: | No data. |
| Water Solubility: | 39 g/l (soluble in alcohols) |
| Solubility: | 39 g/l (soluble in alcohols) |
| Appearance: | white powder |
| Specification: |
Dicyclohexylammonium nitrite,its CAS NO. is 3129-91-7,the synonyms is Nitrous acid dicyclohexylamine ; n,n-Dicyclohexylammonium nitrite ; Dicyclohexylamine nitrite ; Dicyclohexylammonium nitrite ; Dodecahydrodiphenylamine nitrite ; Biscyclohexylaminenitrite ; Cyclohexanamine, n-cyclohexyl-, nitrite ; Cyclohexanamine,n-cyclohexyl-,nitrite . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 100 C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | COLORLESS LIQUID |
| Usage: | Corrosion inhibitor. |
| Safety Data | |
 |
|
