| Identification | |
| Name: | NONYLPHENOXYPOLYETHYLENEOXY ETHANOL-IODINE COMPLEX |
| Synonyms: | Iosan;Lorasol CCT;Byacin;FS 103II;Poly(oxy-1,2-ethanediyl),R-(nonylphenyl)-?- hydroxy-,compd. with iodine;Biopal VRO 20;BacStop;Antarox VRO 20;BIOPAL NR-20;BIOPAL CVL-10;BIOPAL VRO 10;Nonylphenoxypoly(Ethyleneoxy)Ethanol-Iodine Complex; |
| CAS: | 11096-42-7 |
| Molecular Formula: | (C2H4O)n•C15H24O•xI2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H28O2.I2/c1-2-3-4-5-6-7-8-9-16-10-12-17(13-11-16)19-15-14-18;1-2/h10-13,18H,2-9,14-15H2,1H3; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.6°C |
| Boiling Point: | 385.2°C at 760 mmHg |
| Specification: |
Nonylphenoxypolyethanol-iodine complex ,its cas register number is 11096-42-7. It also can be called (Nonylphenoxy)poly(ethyleneoxy)ethanol iodine ; and Poly(oxy-1,2-ethanediyl), alpha-(nonylphenyl)-omega-hydroxy-, compd. with iodine . Nonylphenoxypolyethanol-iodine complex (CAS NO.11096-42-7) is the cause mastitis in cattle. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 155.6°C |
| Usage: | Bio-Surf(R) I-20 is a surfactant-iodine complex with effective biocidal properties. |
| Safety Data | |
 |
|
