| Identification | |
| Name: | Polyvinylpyrrolidone - iodine complex |
| Synonyms: | Tegodyne;Poly(1-(2-Oxo-1-Pyrrolidinyl)Ethylene)-Iodine Complex;Povidoneiodine;1-Ethenyl-2-pyrrolidinone homopolymer compound with iodine;1-Vinyl-2-pyrrolidinone polymer, compd. with iodine;2-Pyrrolidinone, 1-ethenyl-, homopolymer, compd. with iodine;Argentyne; |
| CAS: | 25655-41-8 |
| EINECS: | 215-034-3 |
| Molecular Formula: | (C6H9NO)x. xI2 |
| Molecular Weight: | 364.95 |
| InChI: | InChI=1S/C6H9NO.I2/c1-2-7-5-3-4-6(7)8;1-2/h2H,1,3-5H2; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 93.9 oC |
| Boiling Point: | 217.6oC at 760 mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | soluble |
| Appearance: | A red-brown crystalline powder |
| Flash Point: | 93.9 oC |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Store in air tight containers. |
| Color: | Yellowish-brown amorphous hygroscopic powder |
| Usage: | A topical antiseptic. |
| Safety Data | |
 |
|
