| Identification | |
| Name: | Propanamide,N,N-diethyl- |
| Synonyms: | Propionamide,N,N-diethyl- (6CI,7CI,8CI);Diethylpropionamide;N,N-Diethylpropanamide;NSC 105; |
| CAS: | 1114-51-8 |
| Molecular Formula: | C7H15NO |
| Molecular Weight: | 129.2 |
| InChI: | InChI=1/C7H15NO/c1-4-7(9)8(5-2)6-3/h4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -22 |
| Flash Point: | 163? |
| Density: | 0.897 |
| Refractive index: | 1.442 |
| Solubility: | 19 g/L (25 C) |
| Appearance: | colorless clear liquid |
| Specification: |
N,N-Diethylpropionamide (1114-51-8) also can be called Diethylamide of propionic acid ; Propanamide, N,N-diethyl- ; Diethylamide of propionic acid . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 163? |
| Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. Store in a cool dry place. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
