| Identification | |
| Name: | 1,3-Propane sultone |
| Synonyms: | 3-Hydroxy-1-propanesulfonic acid (gamma) sultone; Propanesultone,99%; 1,3-Propanesultone; 1,2-Oxathiolane-2,2-dioxide; 3-Hydroxy-1-propanesulphonic acid gamma-sultone; 1,2-Oxathiolane 2,2-dioxide; 1,2-OXATHIOLANE 2,2-DIOXIDE (1,3-PROPANE SULTONE); 3-Hydroxy-1-propanesulfonic acid gamma-sultone; Propane sultone; 1,3-PS; 2-Mercapto thiazoline |
| CAS: | 1120-71-4 |
| EINECS: | 214-317-9 |
| Molecular Formula: | C3H6O3S |
| Molecular Weight: | 122.14 |
| InChI: | InChI=1/C3H6O3S/c4-7(5)3-1-2-6-7/h1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.392 |
| Stability: | Stable, but moisture sensitive. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Water Solubility: | Slightly Soluble |
| Solubility: | 100g/l, soluble in organic solvents, insoluble in aliatic hydrocarbons. |
| Appearance: | Clear Crystals |
| Specification: | 1,3-Propanesultone (CAS NO.1120-71-4) releases a foul odor when melting. It reacts slowly with water to give 3-hydroxopropanesulfonic acid. This reaction may be accelerated by acid. May react with strong reducing agents to give toxic and flammable hydrogen sulfide. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Color: | COLORLESS LIQ OR WHITE CRYSTALS White, crystalline solid or a colorless liquid (above 86 degrees F). |
| Usage: | 1,3-Propane sultone is used as chemical intermediate to introduce sulfopropyl group into molecules, & to confer water solubility & anionic character. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
