| Identification | |
| Name: | Phenol, 4-methoxy-,potassium salt (1:1) |
| Synonyms: | Phenol,4-methoxy-, potassium salt (9CI); Phenol, p-methoxy-, potassium deriv. (6CI);Phenol, p-methoxy-, potassium salt (8CI); Potassium, (p-methoxyphenoxy)- (7CI);Potassium 4-methoxyphenolate; Potassium 4-methoxyphenoxide; Potassiump-methoxyphenolate; Potassium p-methoxyphenoxide; p-Methoxyphenol potassiumsalt |
| CAS: | 1122-93-6 |
| EINECS: | 214-366-6 |
| Molecular Formula: | C7H8 O2 . K |
| Molecular Weight: | 162.22758 |
| InChI: | InChI=1/C7H8O2.K/c1-9-7-4-2-6(8)3-5-7;/h2-5,8H,1H3;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 57 deg C |
| Flash Point: | 120.8°C |
| Boiling Point: | 243°Cat760mmHg |
| Density: | 1.109g/cm3 |
| Solubility: | Soluble in benzene, carbon tetrachloride; very soluble in ethanol, ether Readily soluble in acetone and ethyl acetate. In water, 40,000 mg/L at 25 deg C |
| Flash Point: | 120.8°C |
| Color: | Plates White waxy solid White to tan, flaky, crystalline substance Colorless to white, waxy solid. |
| Safety Data | |
 |
|
