| Identification | |
| Name: | 5-Hydroxytryptophan DL-form |
| Synonyms: | 5-hydroxy tryptophan,dl-;(+-)-5-Hydroxytryptophan;5-22-14-00278 (Beilstein Handbook Reference);BRN 0088199;DL-Pretonine;NSC 92523;UNII-9181P3OI6N;dl-Hydroxytryptophan;5-Hydroxy-DL-tryptophan;DL-Tryptophen, 5-hydroxy- (9CI);Tryptophan, 5-hydroxy-, DL-; |
| CAS: | 114-03-4 |
| EINECS: | 204-039-6 |
| Molecular Formula: | C11H12N2O3 |
| Molecular Weight: | 220.22 |
| InChI: | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 298-300°C |
| Boiling Point: | 218-219C |
| Density: | 1,00g/cm |
| Refractive index: | 1,565 |
| Solubility: | Solubilities: 2.5 g/100 mL in 50% boiling alcohol; 5.5 g/100 mL in water at 100 deg C In water, 1X10+4 mg/L at 5 deg C |
| Specification: |
dl-Hydroxytryptophan , its cas register number is 114-03-4. It also can be called (+-)-5-Hydroxytryptophan ; 5-22-14-00278 (Beilstein Handbook Reference) ; DL-Pretonine ; NSC 92523 ; UNII-9181P3OI6N ; 5-Hydroxytryptophan DL-form ; 5-hydroxy tryptophan,dl- . dl-Hydroxytryptophan (CAS NO.114-03-4) is a white to light beige powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Refrigerator |
| Color: | Minute rods or needles from ethanol |
| Safety Data | |
 |
|
