| Identification | |
| Name: | L-Glutamicacid, N-acetyl- |
| Synonyms: | Acetyl glutamic acid; |
| CAS: | 1188-37-0 |
| EINECS: | 214-708-4 |
| Molecular Formula: | C7H11NO5 |
| Molecular Weight: | 189.17 |
| InChI: | InChI=1/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 253.7°C |
| Boiling Point: | 495.9°Cat760mmHg |
| Density: | 1.354g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | -15 ° (C=1, H2O) |
| Alpha: | -16 o (C=1, WATER) |
| Solubility: | 2.7 g/100 mL (20 oC) |
| Appearance: | White solid. |
| HS Code: | 29241900 |
| Flash Point: | 253.7°C |
| Usage: | Activates carbamoyl phosphate synthase in the urea cycle. |
| Safety Data | |
 |
|
