| Identification | |
| Name: | Glutamicacid |
| CAS: | 617-65-2 |
| EINECS: | 210-522-2 |
| Molecular Formula: | C5H9NO4 |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.409 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.522 |
| Solubility: | Very soluble |
| Appearance: | White crystaline or crystaline powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | L form is one of the 20 proteinogenic amino acids. Non-essential. |
| Safety Data | |
 |
|
