| Identification | |
| Name: | 4-Chlorobenzhydrol |
| Synonyms: | Benzhydrol,4-chloro- (6CI,7CI,8CI);(4-Chlorophenyl)phenylmethanol;4-Chloro-a-phenylbenzenemethanol; |
| CAS: | 119-56-2 |
| EINECS: | 204-333-4 |
| Molecular Formula: | C13H11ClO |
| Molecular Weight: | 218.68 |
| InChI: | InChI=1/C13H11ClO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9,13,15H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 166.8ºC |
| Boiling Point: | 352.2 ºCat 760 mmHg |
| Density: | 1.221 g/cm3 |
| Refractive index: | 1.609 |
| Water Solubility: | insoluble |
| Solubility: | A clear solution in Alcohol & Acetone. |
| Appearance: | White to off White crystalline powder. |
| Specification: | white crystalline powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 166.8ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
