| Identification | |
| Name: | Benzeneaceticacid, 4-amino- |
| Synonyms: | Aceticacid, (p-aminophenyl)- (6CI,7CI,8CI);2-(4-Aminophenyl)acetic acid;4-(Carboxymethyl)aniline;NSC 7929;p-Aminophenylacetic acid; |
| CAS: | 1197-55-3 |
| EINECS: | 214-828-7 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161.9 oC |
| Boiling Point: | 344 oCat 760 mmHg |
| Density: | 1.268 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | Light yellow to beige powder. |
| HS Code: | 29224995 |
| Flash Point: | 161.9 oC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | It is a non-translocated competitive inhibitor of the epithelial peptide transporter PepT1 |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
