| Identification | |
| Name: | Benzaldehyde,4-(diethylamino)- |
| Synonyms: | 4-Formyl-N,N-diethylaniline;Benzaldehyde,p-(diethylamino)- (6CI,7CI,8CI);4-(Diethylamino)benzaldehyde;4-(N,N-Diethylamino)benzaldehyde;N,N-Diethyl-4-formylaniline;NSC 8782;p-(Diethylamino)benzaldehyde;p-(N,N-Diethylamino)benzaldehyde;p-Formyl-N,N-diethylaniline; |
| CAS: | 120-21-8 |
| EINECS: | 204-377-4 |
| Molecular Formula: | C11H15NO |
| Molecular Weight: | 177.24 |
| InChI: | InChI=1/C11H15NO/c1-3-12(4-2)11-7-5-10(9-13)6-8-11/h5-9H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.029 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.571 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Brown-black crystals. |
| Specification: | dark brown to green coarse crystals or Safety Statements:26-36-61-60-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 61:Avoid release to the environment. Refer to special instructions safety data sheet 60:This material and/or its container must be disposed of as hazardous waste 36/37:Wear suitable protective clothing and gloves |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
