| Identification | |
| Name: | o-Benzyl-p-chlorophenol |
| Synonyms: | o-Cresol,4-chloro-a-phenyl- (6CI,7CI,8CI);2-Benzyl-4-chlorophenol; 2-Hydroxy-5-chlorodiphenylmethane;4-Chloro-2-benzylphenol; 4-Chloro-a-phenyl-o-cresol; 5-Chloro-2-hydroxydiphenylmethane; Bio-Clave;Chlorophene; Clorofene; Clorophene; Ketolin H; NSC 59989; Neosabenyl; NipacideBCP; Nipacide BCP 50; Preventol BP; Santophen; Santophen 1; Septiphene;o-Benzyl-p-chlorophenol; p-Chloro-o-benzylphenol |
| CAS: | 120-32-1 |
| EINECS: | 204-385-8 |
| Molecular Formula: | C13H11 Cl O |
| Molecular Weight: | 218.68 |
| InChI: | InChI=1/C13H11ClO/c14-12-6-7-13(15)11(9-12)8-10-4-2-1-3-5-10/h1-7,9,15H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.188 |
| Stability: | Stable. |
| Water Solubility: | <1 mg/ml |
| Solubility: | <1 mg/ml < Soluble in ethanol, alkaline solutions an |
| Appearance: | Off white to pale yellow flake |
| Specification: | Safety Statements:26-39-60-61-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Keep tightly closed in a cool place in a tightly closed container. |
| Color: | White to light tan or pink flakes |
| Usage: | Active principle or enhancing agent for disinfectants. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
