| Identification | |
| Name: | O-Chlorophenol |
| Synonyms: | 1-chloro-2-hydroxybenzene; 2-chlorophenol; 2-hydroxychlorobenzene; CHLOROPHENOL2-; Chlorophenol, 2-chlorophenolate; 2-chloro-1-hydroxybenzene; 2-Chloro-1-hydroxy-benzene; 2-chloro-pheno; 2-chlorophenol(o-chlorophenol); chloro-2phenol; o-chlorophenicacid; o-chloro-pheno; O-CHLORO PHENOL; 2-Chorophenol |
| CAS: | 95-57-8 |
| EINECS: | 202-433-2 |
| Molecular Formula: | C6H5ClO |
| Molecular Weight: | 128.56 |
| InChI: | InChI=1/C6H5ClO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2021 |
| Density: | 1.262 |
| Stability: | Stable. Hygroscopic. Combustible. Incompatible with oxidizing agents, acid anhydrides, acid chlorides. |
| Refractive index: | 1.558-1.56 |
| Solubility: | 28.5 g/L (20 oC) in water |
| Appearance: | colourless to light brown liquid |
| Specification: |
? 2-Chlorophenol ,?its cas register number is 64058-30-6. It also can be called?2-Chloro-1-hydroxybenzene ; 2-Hydroxychlorobenzene ; EPA Pesticide Chemical Code 062204 ; Pine-O Disinfectant ; RCRA waste number U048 ; Septi-Kleen ; o-Chlorophenic acid ; o-Chlorphenol ; p-Chlorfenol . |
| Report: |
Reported in EPA TSCA Inventory. Chlorophenol compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Color: | Light amber liquid Colorless to yellow brown liquid |
| Usage: | Organic synthesis (dyes). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
