| Identification | |
| Name: | Thallium selenide(TlSe) |
| Synonyms: | Thalliummonoselenide; Thallium(2+) selenide |
| CAS: | 12039-52-0 |
| EINECS: | 234-895-6 |
| Molecular Formula: | SeTl |
| Molecular Weight: | 487.7266 |
| InChI: | InChI=1/H2O3Se.2Tl/c1-4(2)3;;/h(H2,1,2,3);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 340 deg C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Insoluble in water and acids. |
| Report: |
Reported in EPA TSCA Inventory. Selenium and its compounds, as well as thallium and its compounds, are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Color: | Dark gray plates with a metallic luster |
| Safety Data | |
 |
|
